C30H54N4O4 — CID 139953248
[methyl(nonyl)amino]methyl N-[4-[[methyl(nonyl)amino]methoxycarbonylamino]phenyl]carbamate (PubChem CID 139953248) has the molecular formula C30H54N4O4 and a molecular weight of 534.79 g/mol. Its IUPAC name is [methyl(nonyl)amino]methyl N-[4-[[methyl(nonyl)amino]methoxycarbonylamino]phenyl]carbamate.
| Compound Name | [methyl(nonyl)amino]methyl N-[4-[[methyl(nonyl)amino]methoxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139953248 |
| Molecular Formula | C30H54N4O4 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | [methyl(nonyl)amino]methyl N-[4-[[methyl(nonyl)amino]methoxycarbonylamino]phenyl]carbamate |
| SMILES | CCCCCCCCCN(C)COC(=O)Nc1ccc(NC(=O)OCN(C)CCCCCCCCC)cc1 |
| InChI | InChI=1S/C30H54N4O4/c1-5-7-9-11-13-15-17-23-33(3)25-37-29(35)31-27-19-21-28(22-20-27)32-30(36)38-26-34(4)24-18-16-14-12-10-8-6-2/h19-22H,5-18,23-26H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | ULYAFSTVIUWGJC-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|