C34H60N2O4 — CID 139953383
bis[[decyl(ethyl)amino]methyl] benzene-1,2-dicarboxylate (PubChem CID 139953383) has the molecular formula C34H60N2O4 and a molecular weight of 560.86 g/mol. Its IUPAC name is bis[[decyl(ethyl)amino]methyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[[decyl(ethyl)amino]methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139953383 |
| Molecular Formula | C34H60N2O4 |
| Molecular Weight | 560.86 g/mol |
| Exact Mass | 560.46 |
| IUPAC Name | bis[[decyl(ethyl)amino]methyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCCN(CC)COC(=O)c1ccccc1C(=O)OCN(CC)CCCCCCCCCC |
| InChI | InChI=1S/C34H60N2O4/c1-5-9-11-13-15-17-19-23-27-35(7-3)29-39-33(37)31-25-21-22-26-32(31)34(38)40-30-36(8-4)28-24-20-18-16-14-12-10-6-2/h21-22,25-26H,5-20,23-24,27-30H2,1-4H3 |
| InChIKey | FYEJKUQPFTZQKS-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.86 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|