C21H31N3O4S2 — CID 14645113
N-[4-[4-[2-[4-(methanesulfonamido)phenyl]ethyl-methylamino]butyl]phenyl]methanesulfonamide (PubChem CID 14645113) has the molecular formula C21H31N3O4S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-[4-[4-[2-[4-(methanesulfonamido)phenyl]ethyl-methylamino]butyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-[2-[4-(methanesulfonamido)phenyl]ethyl-methylamino]butyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 14645113 |
| Molecular Formula | C21H31N3O4S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[4-[4-[2-[4-(methanesulfonamido)phenyl]ethyl-methylamino]butyl]phenyl]methanesulfonamide |
| SMILES | CN(CCCCc1ccc(NS(C)(=O)=O)cc1)CCc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H31N3O4S2/c1-24(17-15-19-9-13-21(14-10-19)23-30(3,27)28)16-5-4-6-18-7-11-20(12-8-18)22-29(2,25)26/h7-14,22-23H,4-6,15-17H2,1-3H3 |
| InChIKey | IRGQJBWWKKLCJN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|