C19H26N3O5S2- — CID 169226968
1-[2-[2-[4-(methanesulfonamido)phenoxy]ethyl-methylamino]ethyl]-4-[(sulfinatoamino)methyl]benzene (PubChem CID 169226968) has the molecular formula C19H26N3O5S2- and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-[2-[2-[4-(methanesulfonamido)phenoxy]ethyl-methylamino]ethyl]-4-[(sulfinatoamino)methyl]benzene.
| Compound Name | 1-[2-[2-[4-(methanesulfonamido)phenoxy]ethyl-methylamino]ethyl]-4-[(sulfinatoamino)methyl]benzene |
|---|---|
| PubChem CID | 169226968 |
| Molecular Formula | C19H26N3O5S2- |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-[2-[2-[4-(methanesulfonamido)phenoxy]ethyl-methylamino]ethyl]-4-[(sulfinatoamino)methyl]benzene |
| SMILES | CN(CCOc1ccc(NS(C)(=O)=O)cc1)CCc1ccc(CNS(=O)[O-])cc1 |
| InChI | InChI=1S/C19H27N3O5S2/c1-22(12-11-16-3-5-17(6-4-16)15-20-28(23)24)13-14-27-19-9-7-18(8-10-19)21-29(2,25)26/h3-10,20-21H,11-15H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | FZFVBDIADCFVIH-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|