C12H21N2O5S2- — CID 66768922
N-(4-ethylphenyl)methanesulfonamide;1-methoxy-2-(sulfinatoamino)ethane (PubChem CID 66768922) has the molecular formula C12H21N2O5S2- and a molecular weight of 337.44 g/mol. Its IUPAC name is N-(4-ethylphenyl)methanesulfonamide;1-methoxy-2-(sulfinatoamino)ethane.
| Compound Name | N-(4-ethylphenyl)methanesulfonamide;1-methoxy-2-(sulfinatoamino)ethane |
|---|---|
| PubChem CID | 66768922 |
| Molecular Formula | C12H21N2O5S2- |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(4-ethylphenyl)methanesulfonamide;1-methoxy-2-(sulfinatoamino)ethane |
| SMILES | CCc1ccc(NS(C)(=O)=O)cc1.COCCNS(=O)[O-] |
| InChI | InChI=1S/C9H13NO2S.C3H9NO3S/c1-3-8-4-6-9(7-5-8)10-13(2,11)12;1-7-3-2-4-8(5)6/h4-7,10H,3H2,1-2H3;4H,2-3H2,1H3,(H,5,6)/p-1 |
| InChIKey | QYJMDAYZFRKUPL-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|