C23H45N — CID 156867707
1-butyl-4-methylbenzene;N,N-dipropylbutan-1-amine;ethane (PubChem CID 156867707) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is 1-butyl-4-methylbenzene;N,N-dipropylbutan-1-amine;ethane.
| Compound Name | 1-butyl-4-methylbenzene;N,N-dipropylbutan-1-amine;ethane |
|---|---|
| PubChem CID | 156867707 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | 1-butyl-4-methylbenzene;N,N-dipropylbutan-1-amine;ethane |
| SMILES | CC.CCCCN(CCC)CCC.CCCCc1ccc(C)cc1 |
| InChI | InChI=1S/C11H16.C10H23N.C2H6/c1-3-4-5-11-8-6-10(2)7-9-11;1-4-7-10-11(8-5-2)9-6-3;1-2/h6-9H,3-5H2,1-2H3;4-10H2,1-3H3;1-2H3 |
| InChIKey | NNSMARCNQRXFFT-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |