C17H10F3NO3 — CID 118948623
2-[4-(trifluoromethoxy)anilino]naphthalene-1,4-dione (PubChem CID 118948623) has the molecular formula C17H10F3NO3 and a molecular weight of 333.27 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)anilino]naphthalene-1,4-dione.
| Compound Name | 2-[4-(trifluoromethoxy)anilino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 118948623 |
| Molecular Formula | C17H10F3NO3 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-[4-(trifluoromethoxy)anilino]naphthalene-1,4-dione |
| SMILES | O=C1C=C(Nc2ccc(OC(F)(F)F)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H10F3NO3/c18-17(19,20)24-11-7-5-10(6-8-11)21-14-9-15(22)12-3-1-2-4-13(12)16(14)23/h1-9,21H |
| InChIKey | KMNAQXWNBWBAOH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|