C16H12F3N3O3 — CID 139570186
N'-[2-methyl-3,6-dioxo-4-[4-(trifluoromethoxy)anilino]cyclohexa-1,4-dien-1-yl]-N-methylidenemethanimidamide (PubChem CID 139570186) has the molecular formula C16H12F3N3O3 and a molecular weight of 351.28 g/mol. Its IUPAC name is N'-[2-methyl-3,6-dioxo-4-[4-(trifluoromethoxy)anilino]cyclohexa-1,4-dien-1-yl]-N-methylidenemethanimidamide.
| Compound Name | N'-[2-methyl-3,6-dioxo-4-[4-(trifluoromethoxy)anilino]cyclohexa-1,4-dien-1-yl]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 139570186 |
| Molecular Formula | C16H12F3N3O3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N'-[2-methyl-3,6-dioxo-4-[4-(trifluoromethoxy)anilino]cyclohexa-1,4-dien-1-yl]-N-methylidenemethanimidamide |
| SMILES | C=N/C=N/C1=C(C)C(=O)C(Nc2ccc(OC(F)(F)F)cc2)=CC1=O |
| InChI | InChI=1S/C16H12F3N3O3/c1-9-14(21-8-20-2)13(23)7-12(15(9)24)22-10-3-5-11(6-4-10)25-16(17,18)19/h3-8,22H,2H2,1H3/b21-8+ |
| InChIKey | IVYQXOQAMWYDRO-ODCIPOBUSA-N |
| XLogP | 3.04 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|