About 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile
3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile (PubChem CID 10564229) has the molecular formula C17H10N2O2
and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile |
| PubChem CID | 10564229 |
| Molecular Formula | C17H10N2O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile |
| SMILES | N#Cc1cccc(NC2=CC(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C17H10N2O2/c18-10-11-4-3-5-12(8-11)19-15-9-16(20)13-6-1-2-7-14(13)17(15)21/h1-9,19H |
| InChIKey | JSAKRZIWQZPJSR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile?
The IUPAC name of 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile (CID 10564229) is 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile.
What is the SMILES notation for 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile?
The canonical SMILES for 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile is N#Cc1cccc(NC2=CC(=O)c3ccccc3C2=O)c1.
What is the InChIKey of 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile?
The InChIKey is JSAKRZIWQZPJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2O2/c18-10-11-4-3-5-12(8-11)19-15-9-16(20)13-6-1-2-7-14(13)17(15)21/h1-9,19H.
What are the key properties of 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile?
3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile has a molecular weight of 274.28 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,4-dioxonaphthalen-2-yl)amino]benzonitrile is sourced from PubChem (CID 10564229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).