C7H4ClNO4S — CID 14117914
6-chloro-2,2-dioxo-1,2lambda6,3-benzoxathiazin-4-one (PubChem CID 14117914) has the molecular formula C7H4ClNO4S and a molecular weight of 233.63 g/mol. Its IUPAC name is 6-chloro-2,2-dioxo-1,2lambda6,3-benzoxathiazin-4-one.
| Compound Name | 6-chloro-2,2-dioxo-1,2lambda6,3-benzoxathiazin-4-one |
|---|---|
| PubChem CID | 14117914 |
| Molecular Formula | C7H4ClNO4S |
| Molecular Weight | 233.63 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | 6-chloro-2,2-dioxo-1,2lambda6,3-benzoxathiazin-4-one |
| SMILES | O=C1NS(=O)(=O)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C7H4ClNO4S/c8-4-1-2-6-5(3-4)7(10)9-14(11,12)13-6/h1-3H,(H,9,10) |
| InChIKey | AZGJUINXRVVJNN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.63 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |