About 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one
5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one (PubChem CID 169436022) has the molecular formula C4H4ClNO4S
and a molecular weight of 200.58 g/mol. Its IUPAC name is 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one.
Molecular Properties
| Compound Name | 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one |
| PubChem CID | 169436022 |
| Molecular Formula | C4H4ClNO4S |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one |
| SMILES | [13CH3][13C]1=[13C](Cl)C(=O)NS(=O)(=O)O1 |
| InChI | InChI=1S/C4H4ClNO4S/c1-2-3(5)4(7)6-11(8,9)10-2/h1H3,(H,6,7)/i1+1,2+1,3+1 |
| InChIKey | YVZOKLTZSNJEQX-VMIGTVKRSA-N |
| XLogP | -0.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one?
The IUPAC name of 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one (CID 169436022) is 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one.
What is the SMILES notation for 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one?
The canonical SMILES for 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one is [13CH3][13C]1=[13C](Cl)C(=O)NS(=O)(=O)O1.
What is the InChIKey of 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one?
The InChIKey is YVZOKLTZSNJEQX-VMIGTVKRSA-N. The full InChI is InChI=1S/C4H4ClNO4S/c1-2-3(5)4(7)6-11(8,9)10-2/h1H3,(H,6,7)/i1+1,2+1,3+1.
What are the key properties of 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one?
5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one has a molecular weight of 200.58 g/mol, XLogP of -0.15, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-(113C)methyl-2,2-dioxo(5,6-13C2)oxathiazin-4-one is sourced from PubChem (CID 169436022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).