C11H6O4S — CID 14173512
5,5-dioxo-[1]benzothiolo[3,2-b]pyran-2-one (PubChem CID 14173512) has the molecular formula C11H6O4S and a molecular weight of 234.23 g/mol. Its IUPAC name is 5,5-dioxo-[1]benzothiolo[3,2-b]pyran-2-one.
| Compound Name | 5,5-dioxo-[1]benzothiolo[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 14173512 |
| Molecular Formula | C11H6O4S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 5,5-dioxo-[1]benzothiolo[3,2-b]pyran-2-one |
| SMILES | O=c1ccc2c(o1)-c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C11H6O4S/c12-10-6-5-9-11(15-10)7-3-1-2-4-8(7)16(9,13)14/h1-6H |
| InChIKey | ZLNNTAHLAYFAND-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |