C8H5NO4S — CID 6399305
(3E)-3-hydroxyimino-1,1-dioxo-1-benzothiophen-2-one (PubChem CID 6399305) has the molecular formula C8H5NO4S and a molecular weight of 211.20 g/mol. Its IUPAC name is (3E)-3-hydroxyimino-1,1-dioxo-1-benzothiophen-2-one.
| Compound Name | (3E)-3-hydroxyimino-1,1-dioxo-1-benzothiophen-2-one |
|---|---|
| PubChem CID | 6399305 |
| Molecular Formula | C8H5NO4S |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | (3E)-3-hydroxyimino-1,1-dioxo-1-benzothiophen-2-one |
| SMILES | O=C1/C(=N/O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C8H5NO4S/c10-8-7(9-11)5-3-1-2-4-6(5)14(8,12)13/h1-4,11H/b9-7+ |
| InChIKey | POJIANUANJZGOF-VQHVLOKHSA-N |
| XLogP | 0.18 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|