C22H17NO4S — CID 11069208
methyl 2-[(10,10-dioxothioxanthen-9-ylidene)amino]-2-phenylacetate (PubChem CID 11069208) has the molecular formula C22H17NO4S and a molecular weight of 391.45 g/mol. Its IUPAC name is methyl 2-[(10,10-dioxothioxanthen-9-ylidene)amino]-2-phenylacetate.
| Compound Name | methyl 2-[(10,10-dioxothioxanthen-9-ylidene)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 11069208 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | methyl 2-[(10,10-dioxothioxanthen-9-ylidene)amino]-2-phenylacetate |
| SMILES | COC(=O)C(N=C1c2ccccc2S(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C22H17NO4S/c1-27-22(24)20(15-9-3-2-4-10-15)23-21-16-11-5-7-13-18(16)28(25,26)19-14-8-6-12-17(19)21/h2-14,20H,1H3 |
| InChIKey | URMFULUVSSIXLR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|