C11H11NO4S — CID 115071915
methyl 2-amino-2-(1,1-dioxo-1-benzothiophen-2-yl)acetate (PubChem CID 115071915) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is methyl 2-amino-2-(1,1-dioxo-1-benzothiophen-2-yl)acetate.
| Compound Name | methyl 2-amino-2-(1,1-dioxo-1-benzothiophen-2-yl)acetate |
|---|---|
| PubChem CID | 115071915 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | methyl 2-amino-2-(1,1-dioxo-1-benzothiophen-2-yl)acetate |
| SMILES | COC(=O)C(N)C1=Cc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C11H11NO4S/c1-16-11(13)10(12)9-6-7-4-2-3-5-8(7)17(9,14)15/h2-6,10H,12H2,1H3 |
| InChIKey | UAJZAYBPJNGUAB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |