C13H13NO5S — CID 66837184
2-[1-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]ethenylamino]acetic acid (PubChem CID 66837184) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[1-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]ethenylamino]acetic acid.
| Compound Name | 2-[1-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]ethenylamino]acetic acid |
|---|---|
| PubChem CID | 66837184 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-[1-[(1,1-dioxo-1-benzothiophen-2-yl)methoxy]ethenylamino]acetic acid |
| SMILES | C=C(NCC(=O)O)OCC1=Cc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H13NO5S/c1-9(14-7-13(15)16)19-8-11-6-10-4-2-3-5-12(10)20(11,17)18/h2-6,14H,1,7-8H2,(H,15,16) |
| InChIKey | DEKRMLDCIHUKSR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|