C15H13NO3S — CID 117179568
1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-6-amine (PubChem CID 117179568) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-6-amine.
| Compound Name | 1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-6-amine |
|---|---|
| PubChem CID | 117179568 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-6-amine |
| SMILES | Nc1ccc2c(c1)S(=O)(=O)C(COc1ccccc1)=C2 |
| InChI | InChI=1S/C15H13NO3S/c16-12-7-6-11-8-14(20(17,18)15(11)9-12)10-19-13-4-2-1-3-5-13/h1-9H,10,16H2 |
| InChIKey | GSPOLOHXAHCBDA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|