C11H11NO3S — CID 117192438
2-methyl-5-(phenoxymethyl)-1,3-thiazole 1,1-dioxide (PubChem CID 117192438) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-methyl-5-(phenoxymethyl)-1,3-thiazole 1,1-dioxide.
| Compound Name | 2-methyl-5-(phenoxymethyl)-1,3-thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 117192438 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-methyl-5-(phenoxymethyl)-1,3-thiazole 1,1-dioxide |
| SMILES | CC1=NC=C(COc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C11H11NO3S/c1-9-12-7-11(16(9,13)14)8-15-10-5-3-2-4-6-10/h2-7H,8H2,1H3 |
| InChIKey | KRBPUGFKHDOVGD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |