C16H15NO3S — CID 117172475
[1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-4-yl]methanamine (PubChem CID 117172475) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is [1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-4-yl]methanamine.
| Compound Name | [1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-4-yl]methanamine |
|---|---|
| PubChem CID | 117172475 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [1,1-dioxo-2-(phenoxymethyl)-1-benzothiophen-4-yl]methanamine |
| SMILES | NCc1cccc2c1C=C(COc1ccccc1)S2(=O)=O |
| InChI | InChI=1S/C16H15NO3S/c17-10-12-5-4-8-16-15(12)9-14(21(16,18)19)11-20-13-6-2-1-3-7-13/h1-9H,10-11,17H2 |
| InChIKey | ZGKNRIRHJGNVNF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |