C16H14O4S — CID 117179595
2-[(4-methylphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol (PubChem CID 117179595) has the molecular formula C16H14O4S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[(4-methylphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol.
| Compound Name | 2-[(4-methylphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 117179595 |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[(4-methylphenoxy)methyl]-1,1-dioxo-1-benzothiophen-6-ol |
| SMILES | Cc1ccc(OCC2=Cc3ccc(O)cc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C16H14O4S/c1-11-2-6-14(7-3-11)20-10-15-8-12-4-5-13(17)9-16(12)21(15,18)19/h2-9,17H,10H2,1H3 |
| InChIKey | JBUNYNYWBXLOIZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |