C15H12O5S — CID 117183061
2-[(4-hydroxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-7-ol (PubChem CID 117183061) has the molecular formula C15H12O5S and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[(4-hydroxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-7-ol.
| Compound Name | 2-[(4-hydroxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-7-ol |
|---|---|
| PubChem CID | 117183061 |
| Molecular Formula | C15H12O5S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[(4-hydroxyphenoxy)methyl]-1,1-dioxo-1-benzothiophen-7-ol |
| SMILES | O=S1(=O)C(COc2ccc(O)cc2)=Cc2cccc(O)c21 |
| InChI | InChI=1S/C15H12O5S/c16-11-4-6-12(7-5-11)20-9-13-8-10-2-1-3-14(17)15(10)21(13,18)19/h1-8,16-17H,9H2 |
| InChIKey | JUEUVUADYLIFGH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |