C12H8O4S — CID 141005878
4-[(7,7-dioxo-7λ6-thiabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)oxy]phenol (PubChem CID 141005878) has the molecular formula C12H8O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 4-[(7,7-dioxo-7λ6-thiabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)oxy]phenol.
| Compound Name | 4-[(7,7-dioxo-7λ6-thiabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)oxy]phenol |
|---|---|
| PubChem CID | 141005878 |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 4-[(7,7-dioxo-7λ6-thiabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)oxy]phenol |
| SMILES | O=S1(=O)c2cccc(Oc3ccc(O)cc3)c21 |
| InChI | InChI=1S/C12H8O4S/c13-8-4-6-9(7-5-8)16-10-2-1-3-11-12(10)17(11,14)15/h1-7,13H |
| InChIKey | QCLXRDQNOVGYQD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|