C19H14O4 — CID 86171733
[4-(4-hydroxyphenoxy)phenyl]-(3-hydroxyphenyl)methanone (PubChem CID 86171733) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is [4-(4-hydroxyphenoxy)phenyl]-(3-hydroxyphenyl)methanone.
| Compound Name | [4-(4-hydroxyphenoxy)phenyl]-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 86171733 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [4-(4-hydroxyphenoxy)phenyl]-(3-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(Oc2ccc(O)cc2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C19H14O4/c20-15-6-10-18(11-7-15)23-17-8-4-13(5-9-17)19(22)14-2-1-3-16(21)12-14/h1-12,20-21H |
| InChIKey | VNUMOBQLMVLABB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |