C13H10O4 — CID 19931688
(3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone (PubChem CID 19931688) has the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone.
| Compound Name | (3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 19931688 |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone |
| SMILES | O=C(c1cccc(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H10O4/c14-10-3-1-2-8(6-10)13(17)9-4-5-11(15)12(16)7-9/h1-7,14-16H |
| InChIKey | WVWMZIXXIMKKOU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|