C10H10O4S — CID 117197036
2-(1-hydroxyethyl)-1,1-dioxo-1-benzothiophen-7-ol (PubChem CID 117197036) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-1,1-dioxo-1-benzothiophen-7-ol.
| Compound Name | 2-(1-hydroxyethyl)-1,1-dioxo-1-benzothiophen-7-ol |
|---|---|
| PubChem CID | 117197036 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-(1-hydroxyethyl)-1,1-dioxo-1-benzothiophen-7-ol |
| SMILES | CC(O)C1=Cc2cccc(O)c2S1(=O)=O |
| InChI | InChI=1S/C10H10O4S/c1-6(11)9-5-7-3-2-4-8(12)10(7)15(9,13)14/h2-6,11-12H,1H3 |
| InChIKey | CRPHLWYJGZLXNK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |