C10H7BrO3S — CID 117196747
1-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanone (PubChem CID 117196747) has the molecular formula C10H7BrO3S and a molecular weight of 287.13 g/mol. Its IUPAC name is 1-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanone.
| Compound Name | 1-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 117196747 |
| Molecular Formula | C10H7BrO3S |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 285.93 |
| IUPAC Name | 1-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanone |
| SMILES | CC(=O)C1=Cc2cccc(Br)c2S1(=O)=O |
| InChI | InChI=1S/C10H7BrO3S/c1-6(12)9-5-7-3-2-4-8(11)10(7)15(9,13)14/h2-5H,1H3 |
| InChIKey | WASKSSPOJYWEMT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |