About 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone
1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone (PubChem CID 117196491) has the molecular formula C11H7F3O3S
and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone |
| PubChem CID | 117196491 |
| Molecular Formula | C11H7F3O3S |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone |
| SMILES | CC(=O)C1=Cc2cccc(C(F)(F)F)c2S1(=O)=O |
| InChI | InChI=1S/C11H7F3O3S/c1-6(15)9-5-7-3-2-4-8(11(12,13)14)10(7)18(9,16)17/h2-5H,1H3 |
| InChIKey | OGUJWYCGYJDCMO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone?
The IUPAC name of 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone (CID 117196491) is 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone.
What is the SMILES notation for 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone?
The canonical SMILES for 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone is CC(=O)C1=Cc2cccc(C(F)(F)F)c2S1(=O)=O.
What is the InChIKey of 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone?
The InChIKey is OGUJWYCGYJDCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F3O3S/c1-6(15)9-5-7-3-2-4-8(11(12,13)14)10(7)18(9,16)17/h2-5H,1H3.
What are the key properties of 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone?
1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone has a molecular weight of 276.24 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,1-dioxo-7-(trifluoromethyl)-1-benzothiophen-2-yl]ethanone is sourced from PubChem (CID 117196491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).