C12H6Br2O2S — CID 162349580
4,6-dibromodibenzothiophene 5,5-dioxide (PubChem CID 162349580) has the molecular formula C12H6Br2O2S and a molecular weight of 374.05 g/mol. Its IUPAC name is 4,6-dibromodibenzothiophene 5,5-dioxide.
| Compound Name | 4,6-dibromodibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 162349580 |
| Molecular Formula | C12H6Br2O2S |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 371.85 |
| IUPAC Name | 4,6-dibromodibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2c(Br)cccc2-c2cccc(Br)c21 |
| InChI | InChI=1S/C12H6Br2O2S/c13-9-5-1-3-7-8-4-2-6-10(14)12(8)17(15,16)11(7)9/h1-6H |
| InChIKey | XANUKIBKINCCQF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |