C10H10BrNO2S — CID 117197530
2-(7-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanamine (PubChem CID 117197530) has the molecular formula C10H10BrNO2S and a molecular weight of 288.17 g/mol. Its IUPAC name is 2-(7-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanamine.
| Compound Name | 2-(7-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 117197530 |
| Molecular Formula | C10H10BrNO2S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 2-(7-bromo-1,1-dioxo-1-benzothiophen-3-yl)ethanamine |
| SMILES | NCCC1=CS(=O)(=O)c2c(Br)cccc21 |
| InChI | InChI=1S/C10H10BrNO2S/c11-9-3-1-2-8-7(4-5-12)6-15(13,14)10(8)9/h1-3,6H,4-5,12H2 |
| InChIKey | QMRGIFZDVFJVLH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |