C11H13NO3S — CID 117197796
2-(7-methoxy-1,1-dioxo-1-benzothiophen-3-yl)ethanamine (PubChem CID 117197796) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(7-methoxy-1,1-dioxo-1-benzothiophen-3-yl)ethanamine.
| Compound Name | 2-(7-methoxy-1,1-dioxo-1-benzothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 117197796 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(7-methoxy-1,1-dioxo-1-benzothiophen-3-yl)ethanamine |
| SMILES | COc1cccc2c1S(=O)(=O)C=C2CCN |
| InChI | InChI=1S/C11H13NO3S/c1-15-10-4-2-3-9-8(5-6-12)7-16(13,14)11(9)10/h2-4,7H,5-6,12H2,1H3 |
| InChIKey | URMHCYWJTIPQLI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |