C8H7NO4S — CID 102084003
7-methoxy-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 102084003) has the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. Its IUPAC name is 7-methoxy-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 7-methoxy-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 102084003 |
| Molecular Formula | C8H7NO4S |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 7-methoxy-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1cccc2c1S(=O)(=O)NC2=O |
| InChI | InChI=1S/C8H7NO4S/c1-13-6-4-2-3-5-7(6)14(11,12)9-8(5)10/h2-4H,1H3,(H,9,10) |
| InChIKey | FKMRUSIYXJLNLC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |