C7H5Fe2NO3S — CID 175330188
1,1-dioxo-1,2-benzothiazol-3-one;iron (PubChem CID 175330188) has the molecular formula C7H5Fe2NO3S and a molecular weight of 294.88 g/mol. Its IUPAC name is 1,1-dioxo-1,2-benzothiazol-3-one;iron.
| Compound Name | 1,1-dioxo-1,2-benzothiazol-3-one;iron |
|---|---|
| PubChem CID | 175330188 |
| Molecular Formula | C7H5Fe2NO3S |
| Molecular Weight | 294.88 g/mol |
| Exact Mass | 294.87 |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazol-3-one;iron |
| SMILES | O=C1NS(=O)(=O)c2ccccc21.[Fe].[Fe] |
| InChI | InChI=1S/C7H5NO3S.2Fe/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);; |
| InChIKey | IJLNFTPTNYRJDF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.88 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|