C16H14N2O8S2 — CID 172774685
acetic acid;bis(1,1-dioxo-1,2-benzothiazol-3-one) (PubChem CID 172774685) has the molecular formula C16H14N2O8S2 and a molecular weight of 426.43 g/mol. Its IUPAC name is acetic acid;bis(1,1-dioxo-1,2-benzothiazol-3-one).
| Compound Name | acetic acid;bis(1,1-dioxo-1,2-benzothiazol-3-one) |
|---|---|
| PubChem CID | 172774685 |
| Molecular Formula | C16H14N2O8S2 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | acetic acid;bis(1,1-dioxo-1,2-benzothiazol-3-one) |
| SMILES | CC(=O)O.O=C1NS(=O)(=O)c2ccccc21.O=C1NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/2C7H5NO3S.C2H4O2/c2*9-7-5-3-1-2-4-6(5)12(10,11)8-7;1-2(3)4/h2*1-4H,(H,8,9);1H3,(H,3,4) |
| InChIKey | NKRDSOWWBRATKT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 163.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |