C7H7NNaO4S+ — CID 18324648
sodium;1,1-dioxo-1,2-benzothiazol-3-one;hydrate (PubChem CID 18324648) has the molecular formula C7H7NNaO4S+ and a molecular weight of 224.19 g/mol. Its IUPAC name is sodium;1,1-dioxo-1,2-benzothiazol-3-one;hydrate.
| Compound Name | sodium;1,1-dioxo-1,2-benzothiazol-3-one;hydrate |
|---|---|
| PubChem CID | 18324648 |
| Molecular Formula | C7H7NNaO4S+ |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | sodium;1,1-dioxo-1,2-benzothiazol-3-one;hydrate |
| SMILES | O.O=C1NS(=O)(=O)c2ccccc21.[Na+] |
| InChI | InChI=1S/C7H5NO3S.Na.H2O/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);;1H2/q;+1; |
| InChIKey | ILJOYZVVZZFIKA-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |