C7H7NO4S — CID 66978509
1,1-dioxo-1,2-benzothiazol-3-one;hydrate (PubChem CID 66978509) has the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. Its IUPAC name is 1,1-dioxo-1,2-benzothiazol-3-one;hydrate.
| Compound Name | 1,1-dioxo-1,2-benzothiazol-3-one;hydrate |
|---|---|
| PubChem CID | 66978509 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazol-3-one;hydrate |
| SMILES | O.O=C1NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C7H5NO3S.H2O/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;/h1-4H,(H,8,9);1H2 |
| InChIKey | BPFBRCLHLQNRKL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |