C7H6NO3S+ — CID 135264124
1,1-dioxo-1,2-benzothiazol-3-one;hydron (PubChem CID 135264124) has the molecular formula C7H6NO3S+ and a molecular weight of 184.20 g/mol. Its IUPAC name is 1,1-dioxo-1,2-benzothiazol-3-one;hydron.
| Compound Name | 1,1-dioxo-1,2-benzothiazol-3-one;hydron |
|---|---|
| PubChem CID | 135264124 |
| Molecular Formula | C7H6NO3S+ |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazol-3-one;hydron |
| SMILES | O=C1NS(=O)(=O)c2ccccc21.[H+] |
| InChI | InChI=1S/C7H5NO3S/c9-7-5-3-1-2-4-6(5)12(10,11)8-7/h1-4H,(H,8,9)/p+1 |
| InChIKey | CVHZOJJKTDOEJC-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |