About CID 67677158
CID 67677158 (PubChem CID 67677158) has the molecular formula C14H10KN2O6S2
and a molecular weight of 405.47 g/mol.
Molecular Properties
| Compound Name | CID 67677158 |
| PubChem CID | 67677158 |
| Molecular Formula | C14H10KN2O6S2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | — |
| SMILES | O=C1NS(=O)(=O)c2ccccc21.O=C1NS(=O)(=O)c2ccccc21.[K] |
| InChI | InChI=1S/2C7H5NO3S.K/c2*9-7-5-3-1-2-4-6(5)12(10,11)8-7;/h2*1-4H,(H,8,9); |
| InChIKey | OXMALHPBSTUXQB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 67677158 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67677158?
The IUPAC name of CID 67677158 (CID 67677158) is not available.
What is the SMILES notation for CID 67677158?
The canonical SMILES for CID 67677158 is O=C1NS(=O)(=O)c2ccccc21.O=C1NS(=O)(=O)c2ccccc21.[K].
What is the InChIKey of CID 67677158?
The InChIKey is OXMALHPBSTUXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5NO3S.K/c2*9-7-5-3-1-2-4-6(5)12(10,11)8-7;/h2*1-4H,(H,8,9);.
What are the key properties of CID 67677158?
CID 67677158 has a molecular weight of 405.47 g/mol, XLogP of -0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67677158 is sourced from PubChem (CID 67677158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).