C12H15N3O3 — CID 62069714
2-[5-(2,3-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]ethanamine (PubChem CID 62069714) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-[5-(2,3-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]ethanamine.
| Compound Name | 2-[5-(2,3-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 62069714 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-[5-(2,3-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
| SMILES | COc1cccc(-c2nnc(CCN)o2)c1OC |
| InChI | InChI=1S/C12H15N3O3/c1-16-9-5-3-4-8(11(9)17-2)12-15-14-10(18-12)6-7-13/h3-5H,6-7,13H2,1-2H3 |
| InChIKey | BVPGQIGOTGRPAP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |