C12H15N3O2 — CID 113452620
3-methoxy-4-(5-propyl-1,3,4-oxadiazol-2-yl)aniline (PubChem CID 113452620) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-methoxy-4-(5-propyl-1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | 3-methoxy-4-(5-propyl-1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 113452620 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-methoxy-4-(5-propyl-1,3,4-oxadiazol-2-yl)aniline |
| SMILES | CCCc1nnc(-c2ccc(N)cc2OC)o1 |
| InChI | InChI=1S/C12H15N3O2/c1-3-4-11-14-15-12(17-11)9-6-5-8(13)7-10(9)16-2/h5-7H,3-4,13H2,1-2H3 |
| InChIKey | ACBKEZAVRHQLOD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|