C16H20ClNO2 — CID 69173807
2-[2-(2,3-dimethoxyphenyl)phenyl]ethanamine;hydrochloride (PubChem CID 69173807) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 2-[2-(2,3-dimethoxyphenyl)phenyl]ethanamine;hydrochloride.
| Compound Name | 2-[2-(2,3-dimethoxyphenyl)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 69173807 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[2-(2,3-dimethoxyphenyl)phenyl]ethanamine;hydrochloride |
| SMILES | COc1cccc(-c2ccccc2CCN)c1OC.Cl |
| InChI | InChI=1S/C16H19NO2.ClH/c1-18-15-9-5-8-14(16(15)19-2)13-7-4-3-6-12(13)10-11-17;/h3-9H,10-11,17H2,1-2H3;1H |
| InChIKey | KEEMVHKAEKMGHC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |