C19H14O3S — CID 167107193
4-methyl-5,5-dioxo-6-phenyldibenzothiophen-2-ol (PubChem CID 167107193) has the molecular formula C19H14O3S and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-methyl-5,5-dioxo-6-phenyldibenzothiophen-2-ol.
| Compound Name | 4-methyl-5,5-dioxo-6-phenyldibenzothiophen-2-ol |
|---|---|
| PubChem CID | 167107193 |
| Molecular Formula | C19H14O3S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-methyl-5,5-dioxo-6-phenyldibenzothiophen-2-ol |
| SMILES | Cc1cc(O)cc2c1S(=O)(=O)c1c(-c3ccccc3)cccc1-2 |
| InChI | InChI=1S/C19H14O3S/c1-12-10-14(20)11-17-16-9-5-8-15(13-6-3-2-4-7-13)19(16)23(21,22)18(12)17/h2-11,20H,1H3 |
| InChIKey | CYENNPAHYOSRKJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |