About 2-bromophenol;propan-2-one
2-bromophenol;propan-2-one (PubChem CID 157131819) has the molecular formula C9H11BrO2
and a molecular weight of 231.09 g/mol. Its IUPAC name is 2-bromophenol;propan-2-one.
Molecular Properties
| Compound Name | 2-bromophenol;propan-2-one |
| PubChem CID | 157131819 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 2-bromophenol;propan-2-one |
| SMILES | CC(C)=O.Oc1ccccc1Br |
| InChI | InChI=1S/C6H5BrO.C3H6O/c7-5-3-1-2-4-6(5)8;1-3(2)4/h1-4,8H;1-2H3 |
| InChIKey | AJDXIWOESQWDHQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromophenol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromophenol;propan-2-one?
The IUPAC name of 2-bromophenol;propan-2-one (CID 157131819) is 2-bromophenol;propan-2-one.
What is the SMILES notation for 2-bromophenol;propan-2-one?
The canonical SMILES for 2-bromophenol;propan-2-one is CC(C)=O.Oc1ccccc1Br.
What is the InChIKey of 2-bromophenol;propan-2-one?
The InChIKey is AJDXIWOESQWDHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO.C3H6O/c7-5-3-1-2-4-6(5)8;1-3(2)4/h1-4,8H;1-2H3.
What are the key properties of 2-bromophenol;propan-2-one?
2-bromophenol;propan-2-one has a molecular weight of 231.09 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromophenol;propan-2-one is sourced from PubChem (CID 157131819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).