About 2-bromophenol;ethane;methoxyethane
2-bromophenol;ethane;methoxyethane (PubChem CID 91423114) has the molecular formula C11H19BrO2
and a molecular weight of 263.18 g/mol. Its IUPAC name is 2-bromophenol;ethane;methoxyethane.
Molecular Properties
| Compound Name | 2-bromophenol;ethane;methoxyethane |
| PubChem CID | 91423114 |
| Molecular Formula | C11H19BrO2 |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-bromophenol;ethane;methoxyethane |
| SMILES | CC.CCOC.Oc1ccccc1Br |
| InChI | InChI=1S/C6H5BrO.C3H8O.C2H6/c7-5-3-1-2-4-6(5)8;1-3-4-2;1-2/h1-4,8H;3H2,1-2H3;1-2H3 |
| InChIKey | FWTRIUFSSRXJGF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromophenol;ethane;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromophenol;ethane;methoxyethane?
The IUPAC name of 2-bromophenol;ethane;methoxyethane (CID 91423114) is 2-bromophenol;ethane;methoxyethane.
What is the SMILES notation for 2-bromophenol;ethane;methoxyethane?
The canonical SMILES for 2-bromophenol;ethane;methoxyethane is CC.CCOC.Oc1ccccc1Br.
What is the InChIKey of 2-bromophenol;ethane;methoxyethane?
The InChIKey is FWTRIUFSSRXJGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO.C3H8O.C2H6/c7-5-3-1-2-4-6(5)8;1-3-4-2;1-2/h1-4,8H;3H2,1-2H3;1-2H3.
What are the key properties of 2-bromophenol;ethane;methoxyethane?
2-bromophenol;ethane;methoxyethane has a molecular weight of 263.18 g/mol, XLogP of 3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromophenol;ethane;methoxyethane is sourced from PubChem (CID 91423114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).