About 2-bromophenol;3-bromoprop-1-ene
2-bromophenol;3-bromoprop-1-ene (PubChem CID 175256619) has the molecular formula C9H10Br2O
and a molecular weight of 293.99 g/mol. Its IUPAC name is 2-bromophenol;3-bromoprop-1-ene.
Molecular Properties
| Compound Name | 2-bromophenol;3-bromoprop-1-ene |
| PubChem CID | 175256619 |
| Molecular Formula | C9H10Br2O |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.91 |
| IUPAC Name | 2-bromophenol;3-bromoprop-1-ene |
| SMILES | C=CCBr.Oc1ccccc1Br |
| InChI | InChI=1S/C6H5BrO.C3H5Br/c7-5-3-1-2-4-6(5)8;1-2-3-4/h1-4,8H;2H,1,3H2 |
| InChIKey | YPDCPSDULLNJLO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromophenol;3-bromoprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromophenol;3-bromoprop-1-ene?
The IUPAC name of 2-bromophenol;3-bromoprop-1-ene (CID 175256619) is 2-bromophenol;3-bromoprop-1-ene.
What is the SMILES notation for 2-bromophenol;3-bromoprop-1-ene?
The canonical SMILES for 2-bromophenol;3-bromoprop-1-ene is C=CCBr.Oc1ccccc1Br.
What is the InChIKey of 2-bromophenol;3-bromoprop-1-ene?
The InChIKey is YPDCPSDULLNJLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO.C3H5Br/c7-5-3-1-2-4-6(5)8;1-2-3-4/h1-4,8H;2H,1,3H2.
What are the key properties of 2-bromophenol;3-bromoprop-1-ene?
2-bromophenol;3-bromoprop-1-ene has a molecular weight of 293.99 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromophenol;3-bromoprop-1-ene is sourced from PubChem (CID 175256619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).