C13H12Br2 — CID 177036030
1-bromo-2-[(2Z,4Z)-2-bromohepta-2,4,6-trien-3-yl]benzene (PubChem CID 177036030) has the molecular formula C13H12Br2 and a molecular weight of 328.05 g/mol. Its IUPAC name is 1-bromo-2-[(2Z,4Z)-2-bromohepta-2,4,6-trien-3-yl]benzene.
| Compound Name | 1-bromo-2-[(2Z,4Z)-2-bromohepta-2,4,6-trien-3-yl]benzene |
|---|---|
| PubChem CID | 177036030 |
| Molecular Formula | C13H12Br2 |
| Molecular Weight | 328.05 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | 1-bromo-2-[(2Z,4Z)-2-bromohepta-2,4,6-trien-3-yl]benzene |
| SMILES | C=C/C=C\C(=C(/C)Br)c1ccccc1Br |
| InChI | InChI=1S/C13H12Br2/c1-3-4-7-11(10(2)14)12-8-5-6-9-13(12)15/h3-9H,1H2,2H3/b7-4-,11-10- |
| InChIKey | JVFWNOCIDCKAKI-ZDXSPKKTSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.05 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|