C16H23Br — CID 145141149
1-bromo-2-[(3E)-hexa-1,3,5-trien-3-yl]benzene;ethane (PubChem CID 145141149) has the molecular formula C16H23Br and a molecular weight of 295.26 g/mol. Its IUPAC name is 1-bromo-2-[(3E)-hexa-1,3,5-trien-3-yl]benzene;ethane.
| Compound Name | 1-bromo-2-[(3E)-hexa-1,3,5-trien-3-yl]benzene;ethane |
|---|---|
| PubChem CID | 145141149 |
| Molecular Formula | C16H23Br |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-bromo-2-[(3E)-hexa-1,3,5-trien-3-yl]benzene;ethane |
| SMILES | C=C/C=C(\C=C)c1ccccc1Br.CC.CC |
| InChI | InChI=1S/C12H11Br.2C2H6/c1-3-7-10(4-2)11-8-5-6-9-12(11)13;2*1-2/h3-9H,1-2H2;2*1-2H3/b10-7+;; |
| InChIKey | VLSMIWIXHUMYPA-WRQJSNHTSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|