C16H20FNO — CID 143768663
ethane;2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylbenzamide (PubChem CID 143768663) has the molecular formula C16H20FNO and a molecular weight of 261.34 g/mol. Its IUPAC name is ethane;2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylbenzamide.
| Compound Name | ethane;2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 143768663 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | ethane;2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylbenzamide |
| SMILES | C=C/C=C(\C=C)c1cccc(C(=O)NC)c1F.CC |
| InChI | InChI=1S/C14H14FNO.C2H6/c1-4-7-10(5-2)11-8-6-9-12(13(11)15)14(17)16-3;1-2/h4-9H,1-2H2,3H3,(H,16,17);1-2H3/b10-7+; |
| InChIKey | LKHBCWYABSUEMG-HCUGZAAXSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|