C13H12FNO — CID 143768621
2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]benzamide (PubChem CID 143768621) has the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. Its IUPAC name is 2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]benzamide.
| Compound Name | 2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]benzamide |
|---|---|
| PubChem CID | 143768621 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-fluoro-3-[(3E)-hexa-1,3,5-trien-3-yl]benzamide |
| SMILES | C=C/C=C(\C=C)c1cccc(C(N)=O)c1F |
| InChI | InChI=1S/C13H12FNO/c1-3-6-9(4-2)10-7-5-8-11(12(10)14)13(15)16/h3-8H,1-2H2,(H2,15,16)/b9-6+ |
| InChIKey | AHCZSXSJDXZLDF-RMKNXTFCSA-N |
| XLogP | 2.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|