C13H14FNO — CID 142305806
2-fluoro-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]benzamide (PubChem CID 142305806) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-fluoro-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]benzamide.
| Compound Name | 2-fluoro-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]benzamide |
|---|---|
| PubChem CID | 142305806 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-fluoro-4-methyl-5-[(3E)-penta-1,3-dien-3-yl]benzamide |
| SMILES | C=C/C(=C\C)c1cc(C(N)=O)c(F)cc1C |
| InChI | InChI=1S/C13H14FNO/c1-4-9(5-2)10-7-11(13(15)16)12(14)6-8(10)3/h4-7H,1H2,2-3H3,(H2,15,16)/b9-5+ |
| InChIKey | YQUXNJWUDMWFNX-WEVVVXLNSA-N |
| XLogP | 2.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|