C11H10FNO — CID 123226299
5-buta-1,3-dien-2-yl-2-fluorobenzamide (PubChem CID 123226299) has the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-2-fluorobenzamide.
| Compound Name | 5-buta-1,3-dien-2-yl-2-fluorobenzamide |
|---|---|
| PubChem CID | 123226299 |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-2-fluorobenzamide |
| SMILES | C=CC(=C)c1ccc(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C11H10FNO/c1-3-7(2)8-4-5-10(12)9(6-8)11(13)14/h3-6H,1-2H2,(H2,13,14) |
| InChIKey | XNNCRMWZZBSGRJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|